C2H5NaO7P2Zn — CID 155680858
sodium;zinc;hydroxy-(2-hydroxy-1-phosphonatoethyl)phosphinate (PubChem CID 155680858) has the molecular formula C2H5NaO7P2Zn and a molecular weight of 291.38 g/mol. Its IUPAC name is sodium;zinc;hydroxy-(2-hydroxy-1-phosphonatoethyl)phosphinate.
| Compound Name | sodium;zinc;hydroxy-(2-hydroxy-1-phosphonatoethyl)phosphinate |
|---|---|
| PubChem CID | 155680858 |
| Molecular Formula | C2H5NaO7P2Zn |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 289.87 |
| IUPAC Name | sodium;zinc;hydroxy-(2-hydroxy-1-phosphonatoethyl)phosphinate |
| SMILES | O=P([O-])([O-])C(CO)P(=O)([O-])O.[Na+].[Zn+2] |
| InChI | InChI=1S/C2H8O7P2.Na.Zn/c3-1-2(10(4,5)6)11(7,8)9;;/h2-3H,1H2,(H2,4,5,6)(H2,7,8,9);;/q;+1;+2/p-3 |
| InChIKey | QUQQGJUAWWRFJE-UHFFFAOYSA-K |
| XLogP | -6.23 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | -6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|