C27H24FN5O3S — CID 155681191
(4-carbamimidoyl-2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate (PubChem CID 155681191) has the molecular formula C27H24FN5O3S and a molecular weight of 517.59 g/mol. Its IUPAC name is (4-carbamimidoyl-2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | (4-carbamimidoyl-2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 155681191 |
| Molecular Formula | C27H24FN5O3S |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (4-carbamimidoyl-2-fluorophenyl) 2-(4-benzamidopiperidin-1-yl)-1,3-benzothiazole-6-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc3nc(N4CCC(NC(=O)c5ccccc5)CC4)sc3c2)c(F)c1 |
| InChI | InChI=1S/C27H24FN5O3S/c28-20-14-17(24(29)30)7-9-22(20)36-26(35)18-6-8-21-23(15-18)37-27(32-21)33-12-10-19(11-13-33)31-25(34)16-4-2-1-3-5-16/h1-9,14-15,19H,10-13H2,(H3,29,30)(H,31,34) |
| InChIKey | BBIOJFKWSBVMHI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|