C15H19F2NO3 — CID 155681994
tert-butyl 2,2-difluoro-1-prop-2-ynoyl-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 155681994) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is tert-butyl 2,2-difluoro-1-prop-2-ynoyl-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | tert-butyl 2,2-difluoro-1-prop-2-ynoyl-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 155681994 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl 2,2-difluoro-1-prop-2-ynoyl-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | C#CC(=O)C1C(F)(F)C12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C15H19F2NO3/c1-5-10(19)11-14(15(11,16)17)6-8-18(9-7-14)12(20)21-13(2,3)4/h1,11H,6-9H2,2-4H3 |
| InChIKey | HBCCGGTWXXDNKE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|