C17H18Cl2FN3O4 — CID 155683132
[N'-(2-chloroethyl)carbamimidoyl] 3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]bicyclo[1.1.1]pentane-1-carboxylate (PubChem CID 155683132) has the molecular formula C17H18Cl2FN3O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is [N'-(2-chloroethyl)carbamimidoyl] 3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]bicyclo[1.1.1]pentane-1-carboxylate.
| Compound Name | [N'-(2-chloroethyl)carbamimidoyl] 3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]bicyclo[1.1.1]pentane-1-carboxylate |
|---|---|
| PubChem CID | 155683132 |
| Molecular Formula | C17H18Cl2FN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | [N'-(2-chloroethyl)carbamimidoyl] 3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]bicyclo[1.1.1]pentane-1-carboxylate |
| SMILES | N/C(=N\CCCl)OC(=O)C12CC(NC(=O)COc3ccc(Cl)c(F)c3)(C1)C2 |
| InChI | InChI=1S/C17H18Cl2FN3O4/c18-3-4-22-15(21)27-14(25)16-7-17(8-16,9-16)23-13(24)6-26-10-1-2-11(19)12(20)5-10/h1-2,5H,3-4,6-9H2,(H2,21,22)(H,23,24) |
| InChIKey | DURDAOPKAGDJAW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|