C20H22ClFN2O2 — CID 155684545
(4aR)-9-chloro-7-fluoro-8-(2-methoxy-6-methylphenyl)-2,3,4,4a,5,11-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazepine (PubChem CID 155684545) has the molecular formula C20H22ClFN2O2 and a molecular weight of 376.86 g/mol. Its IUPAC name is (4aR)-9-chloro-7-fluoro-8-(2-methoxy-6-methylphenyl)-2,3,4,4a,5,11-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazepine.
| Compound Name | (4aR)-9-chloro-7-fluoro-8-(2-methoxy-6-methylphenyl)-2,3,4,4a,5,11-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazepine |
|---|---|
| PubChem CID | 155684545 |
| Molecular Formula | C20H22ClFN2O2 |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (4aR)-9-chloro-7-fluoro-8-(2-methoxy-6-methylphenyl)-2,3,4,4a,5,11-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazepine |
| SMILES | COc1cccc(C)c1-c1c(Cl)cc2c(c1F)OC[C@H]1CNCCN1C2 |
| InChI | InChI=1S/C20H22ClFN2O2/c1-12-4-3-5-16(25-2)17(12)18-15(21)8-13-10-24-7-6-23-9-14(24)11-26-20(13)19(18)22/h3-5,8,14,23H,6-7,9-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | OZAIUMBEGGFZIB-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |