C20H20Cl2N4O2 — CID 155684222
3-chloro-2-[(8R)-12-chloro-17-methyl-10-oxa-3,6,15,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-13-yl]phenol (PubChem CID 155684222) has the molecular formula C20H20Cl2N4O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is 3-chloro-2-[(8R)-12-chloro-17-methyl-10-oxa-3,6,15,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-13-yl]phenol.
| Compound Name | 3-chloro-2-[(8R)-12-chloro-17-methyl-10-oxa-3,6,15,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-13-yl]phenol |
|---|---|
| PubChem CID | 155684222 |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 3-chloro-2-[(8R)-12-chloro-17-methyl-10-oxa-3,6,15,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-13-yl]phenol |
| SMILES | Cn1cnc2c(-c3c(O)cccc3Cl)c(Cl)c3c(c21)CN1CCNC[C@@H]1CO3 |
| InChI | InChI=1S/C20H20Cl2N4O2/c1-25-10-24-18-16(15-13(21)3-2-4-14(15)27)17(22)20-12(19(18)25)8-26-6-5-23-7-11(26)9-28-20/h2-4,10-11,23,27H,5-9H2,1H3/t11-/m1/s1 |
| InChIKey | GLGMIYVNAHMSRM-LLVKDONJSA-N |
| XLogP | 3.42 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |