C22H25Cl2N3O2S — CID 167132984
3-chloro-2-[(11R)-7-chloro-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]-9-oxa-1,4,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-6-yl]phenol (PubChem CID 167132984) has the molecular formula C22H25Cl2N3O2S and a molecular weight of 466.43 g/mol. Its IUPAC name is 3-chloro-2-[(11R)-7-chloro-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]-9-oxa-1,4,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-6-yl]phenol.
| Compound Name | 3-chloro-2-[(11R)-7-chloro-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]-9-oxa-1,4,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-6-yl]phenol |
|---|---|
| PubChem CID | 167132984 |
| Molecular Formula | C22H25Cl2N3O2S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 3-chloro-2-[(11R)-7-chloro-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]-9-oxa-1,4,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-6-yl]phenol |
| SMILES | CS(C)(C)C#Cc1nc2c(c(Cl)c1-c1c(O)cccc1Cl)OC[C@H]1CNCCN1C2 |
| InChI | InChI=1S/C22H25Cl2N3O2S/c1-30(2,3)10-7-16-20(19-15(23)5-4-6-18(19)28)21(24)22-17(26-16)12-27-9-8-25-11-14(27)13-29-22/h4-6,14,25,28H,8-9,11-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | RLFNJYMHHSFVMW-CQSZACIVSA-N |
| XLogP | 3.93 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|