C23H27ClFN5O3 — CID 172862303
(3S)-4-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-4-yl]-1,3-dimethylpiperazin-2-one (PubChem CID 172862303) has the molecular formula C23H27ClFN5O3 and a molecular weight of 475.95 g/mol. Its IUPAC name is (3S)-4-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-4-yl]-1,3-dimethylpiperazin-2-one.
| Compound Name | (3S)-4-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-4-yl]-1,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 172862303 |
| Molecular Formula | C23H27ClFN5O3 |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (3S)-4-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-4-yl]-1,3-dimethylpiperazin-2-one |
| SMILES | C[C@H]1C(=O)N(C)CCN1c1nc(-c2c(O)cccc2F)c(Cl)c2c1CN1CCNC[C@@H]1CO2 |
| InChI | InChI=1S/C23H27ClFN5O3/c1-13-23(32)28(2)8-9-30(13)22-15-11-29-7-6-26-10-14(29)12-33-21(15)19(24)20(27-22)18-16(25)4-3-5-17(18)31/h3-5,13-14,26,31H,6-12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | ZNBSATGHPLKHOW-UONOGXRCSA-N |
| XLogP | 2.08 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |