C21H24ClFN4O3 — CID 166870312
(11R)-4-(tert-butylamino)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870312) has the molecular formula C21H24ClFN4O3 and a molecular weight of 434.90 g/mol. Its IUPAC name is (11R)-4-(tert-butylamino)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-4-(tert-butylamino)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870312 |
| Molecular Formula | C21H24ClFN4O3 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (11R)-4-(tert-butylamino)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | CC(C)(C)Nc1nc(-c2c(O)cccc2F)c(Cl)c2c1C(=O)N1CCNC[C@@H]1CO2 |
| InChI | InChI=1S/C21H24ClFN4O3/c1-21(2,3)26-19-15-18(30-10-11-9-24-7-8-27(11)20(15)29)16(22)17(25-19)14-12(23)5-4-6-13(14)28/h4-6,11,24,28H,7-10H2,1-3H3,(H,25,26)/t11-/m1/s1 |
| InChIKey | ARAAHSSIMYCBDC-LLVKDONJSA-N |
| XLogP | 3.26 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |