C18H15ClF2N2O3 — CID 155684286
(4aR)-7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-one (PubChem CID 155684286) has the molecular formula C18H15ClF2N2O3 and a molecular weight of 380.78 g/mol. Its IUPAC name is (4aR)-7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-one.
| Compound Name | (4aR)-7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-one |
|---|---|
| PubChem CID | 155684286 |
| Molecular Formula | C18H15ClF2N2O3 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (4aR)-7-chloro-9-fluoro-8-(2-fluoro-6-hydroxyphenyl)-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-one |
| SMILES | O=C1c2cc(F)c(-c3c(O)cccc3F)c(Cl)c2OC[C@H]2CNCCN12 |
| InChI | InChI=1S/C18H15ClF2N2O3/c19-16-15(14-11(20)2-1-3-13(14)24)12(21)6-10-17(16)26-8-9-7-22-4-5-23(9)18(10)25/h1-3,6,9,22,24H,4-5,7-8H2/t9-/m1/s1 |
| InChIKey | ZLFOCYXHXCTCCN-SECBINFHSA-N |
| XLogP | 2.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |