C21H15ClF2N4O2S — CID 170274385
2-amino-4-(7-chloro-9-fluoro-11-oxo-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-8-yl)-7-fluoro-1-benzothiophene-3-carbonitrile (PubChem CID 170274385) has the molecular formula C21H15ClF2N4O2S and a molecular weight of 460.89 g/mol. Its IUPAC name is 2-amino-4-(7-chloro-9-fluoro-11-oxo-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-8-yl)-7-fluoro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-4-(7-chloro-9-fluoro-11-oxo-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-8-yl)-7-fluoro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 170274385 |
| Molecular Formula | C21H15ClF2N4O2S |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 2-amino-4-(7-chloro-9-fluoro-11-oxo-1,2,3,4,4a,5-hexahydropyrazino[2,1-c][1,4]benzoxazepin-8-yl)-7-fluoro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N)sc2c(F)ccc(-c3c(F)cc4c(c3Cl)OCC3CNCCN3C4=O)c12 |
| InChI | InChI=1S/C21H15ClF2N4O2S/c22-17-16(10-1-2-13(23)19-15(10)12(6-25)20(26)31-19)14(24)5-11-18(17)30-8-9-7-27-3-4-28(9)21(11)29/h1-2,5,9,27H,3-4,7-8,26H2 |
| InChIKey | ZHZBVUJGDOCMRM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |