C27H24ClF2N4O3S+ — CID 177352239
[4-[(13aS)-7-butoxy-10-chloro-8-fluoro-6-oxo-2,3,4,12,13,13a-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazocin-9-yl]-3-cyano-7-fluoro-1-benzothiophen-2-yl]-methylidyneazanium (PubChem CID 177352239) has the molecular formula C27H24ClF2N4O3S+ and a molecular weight of 558.03 g/mol. Its IUPAC name is [4-[(13aS)-7-butoxy-10-chloro-8-fluoro-6-oxo-2,3,4,12,13,13a-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazocin-9-yl]-3-cyano-7-fluoro-1-benzothiophen-2-yl]-methylidyneazanium.
| Compound Name | [4-[(13aS)-7-butoxy-10-chloro-8-fluoro-6-oxo-2,3,4,12,13,13a-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazocin-9-yl]-3-cyano-7-fluoro-1-benzothiophen-2-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 177352239 |
| Molecular Formula | C27H24ClF2N4O3S+ |
| Molecular Weight | 558.03 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | [4-[(13aS)-7-butoxy-10-chloro-8-fluoro-6-oxo-2,3,4,12,13,13a-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazocin-9-yl]-3-cyano-7-fluoro-1-benzothiophen-2-yl]-methylidyneazanium |
| SMILES | C#[N+]c1sc2c(F)ccc(-c3c(F)c(OCCCC)c4c(c3Cl)OCC[C@H]3CNCCN3C4=O)c2c1C#N |
| InChI | InChI=1S/C27H24ClF2N4O3S/c1-3-4-10-36-24-20-23(37-11-7-14-13-33-8-9-34(14)27(20)35)21(28)19(22(24)30)15-5-6-17(29)25-18(15)16(12-31)26(32-2)38-25/h2,5-6,14,33H,3-4,7-11,13H2,1H3/q+1/t14-/m0/s1 |
| InChIKey | PIJQGWPJGJXPIS-AWEZNQCLSA-N |
| XLogP | 6.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.03 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|