C30H30F2N4O3S — CID 177366425
4-[(13aS)-10-ethyl-8-fluoro-6-oxo-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-9-yl]-7-fluoro-2-(propan-2-ylamino)-1-benzothiophene-3-carbonitrile (PubChem CID 177366425) has the molecular formula C30H30F2N4O3S and a molecular weight of 564.66 g/mol. Its IUPAC name is 4-[(13aS)-10-ethyl-8-fluoro-6-oxo-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-9-yl]-7-fluoro-2-(propan-2-ylamino)-1-benzothiophene-3-carbonitrile.
| Compound Name | 4-[(13aS)-10-ethyl-8-fluoro-6-oxo-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-9-yl]-7-fluoro-2-(propan-2-ylamino)-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 177366425 |
| Molecular Formula | C30H30F2N4O3S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 4-[(13aS)-10-ethyl-8-fluoro-6-oxo-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-9-yl]-7-fluoro-2-(propan-2-ylamino)-1-benzothiophene-3-carbonitrile |
| SMILES | C=CC(=O)N1CCN2C(=O)c3cc(F)c(-c4ccc(F)c5sc(NC(C)C)c(C#N)c45)c(CC)c3OCC[C@H]2C1 |
| InChI | InChI=1S/C30H30F2N4O3S/c1-5-18-25(19-7-8-22(31)28-26(19)21(14-33)29(40-28)34-16(3)4)23(32)13-20-27(18)39-12-9-17-15-35(24(37)6-2)10-11-36(17)30(20)38/h6-8,13,16-17,34H,2,5,9-12,15H2,1,3-4H3/t17-/m0/s1 |
| InChIKey | SMPJMXQYZIMGNG-KRWDZBQOSA-N |
| XLogP | 5.72 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|