C16H17ClN2O3 — CID 174181014
(13aS)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one (PubChem CID 174181014) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is (13aS)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one.
| Compound Name | (13aS)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one |
|---|---|
| PubChem CID | 174181014 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (13aS)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3cc(Cl)ccc3OCC[C@H]2C1 |
| InChI | InChI=1S/C16H17ClN2O3/c1-2-15(20)18-6-7-19-12(10-18)5-8-22-14-4-3-11(17)9-13(14)16(19)21/h2-4,9,12H,1,5-8,10H2/t12-/m0/s1 |
| InChIKey | NWQFNLVUIXIKGL-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|