C23H21ClN4O4 — CID 167101767
9-(2-amino-1,3-benzoxazol-4-yl)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one (PubChem CID 167101767) has the molecular formula C23H21ClN4O4 and a molecular weight of 452.90 g/mol. Its IUPAC name is 9-(2-amino-1,3-benzoxazol-4-yl)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one.
| Compound Name | 9-(2-amino-1,3-benzoxazol-4-yl)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one |
|---|---|
| PubChem CID | 167101767 |
| Molecular Formula | C23H21ClN4O4 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 9-(2-amino-1,3-benzoxazol-4-yl)-8-chloro-2-prop-2-enoyl-1,3,4,12,13,13a-hexahydropyrazino[2,1-d][1,5]benzoxazocin-6-one |
| SMILES | C=CC(=O)N1CCN2C(=O)c3cc(Cl)c(-c4cccc5oc(N)nc45)cc3OCCC2C1 |
| InChI | InChI=1S/C23H21ClN4O4/c1-2-20(29)27-7-8-28-13(12-27)6-9-31-19-11-15(17(24)10-16(19)22(28)30)14-4-3-5-18-21(14)26-23(25)32-18/h2-5,10-11,13H,1,6-9,12H2,(H2,25,26) |
| InChIKey | CKQXWZIASJCXQO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|