C27H21F2N5O2S — CID 170258276
2-amino-7-fluoro-4-[(8S)-16-fluoro-2-oxo-6-prop-2-enoyl-3,6,11-triazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-1-benzothiophene-3-carbonitrile (PubChem CID 170258276) has the molecular formula C27H21F2N5O2S and a molecular weight of 517.56 g/mol. Its IUPAC name is 2-amino-7-fluoro-4-[(8S)-16-fluoro-2-oxo-6-prop-2-enoyl-3,6,11-triazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-7-fluoro-4-[(8S)-16-fluoro-2-oxo-6-prop-2-enoyl-3,6,11-triazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 170258276 |
| Molecular Formula | C27H21F2N5O2S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-amino-7-fluoro-4-[(8S)-16-fluoro-2-oxo-6-prop-2-enoyl-3,6,11-triazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-1-benzothiophene-3-carbonitrile |
| SMILES | C=CC(=O)N1CCN2C(=O)c3cc(F)c(-c4ccc(F)c5sc(N)c(C#N)c45)c4ccn(c34)CC[C@H]2C1 |
| InChI | InChI=1S/C27H21F2N5O2S/c1-2-21(35)33-9-10-34-14(13-33)5-7-32-8-6-16-22(20(29)11-17(24(16)32)27(34)36)15-3-4-19(28)25-23(15)18(12-30)26(31)37-25/h2-4,6,8,11,14H,1,5,7,9-10,13,31H2/t14-/m0/s1 |
| InChIKey | ZSNKZDVJNOPXKR-AWEZNQCLSA-N |
| XLogP | 4.50 |
| TPSA | 95.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|