C26H19F3N6O2S — CID 170260996
2-amino-4-[(8R)-13,16-difluoro-2-oxo-6-prop-2-enoyl-3,6,11,12-tetrazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-7-fluoro-1-benzothiophene-3-carbonitrile (PubChem CID 170260996) has the molecular formula C26H19F3N6O2S and a molecular weight of 536.54 g/mol. Its IUPAC name is 2-amino-4-[(8R)-13,16-difluoro-2-oxo-6-prop-2-enoyl-3,6,11,12-tetrazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-7-fluoro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-4-[(8R)-13,16-difluoro-2-oxo-6-prop-2-enoyl-3,6,11,12-tetrazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-7-fluoro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 170260996 |
| Molecular Formula | C26H19F3N6O2S |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 2-amino-4-[(8R)-13,16-difluoro-2-oxo-6-prop-2-enoyl-3,6,11,12-tetrazatetracyclo[9.6.1.03,8.014,18]octadeca-1(17),12,14(18),15-tetraen-15-yl]-7-fluoro-1-benzothiophene-3-carbonitrile |
| SMILES | C=CC(=O)N1CCN2C(=O)c3cc(F)c(-c4ccc(F)c5sc(N)c(C#N)c45)c4c(F)nn(c34)CC[C@@H]2C1 |
| InChI | InChI=1S/C26H19F3N6O2S/c1-2-18(36)33-7-8-34-12(11-33)5-6-35-22-14(26(34)37)9-17(28)20(21(22)24(29)32-35)13-3-4-16(27)23-19(13)15(10-30)25(31)38-23/h2-4,9,12H,1,5-8,11,31H2/t12-/m1/s1 |
| InChIKey | UHOMYPSMBURIRF-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|