About ethane;[4-(ethoxymethyl)phenoxy]methyl formate
ethane;[4-(ethoxymethyl)phenoxy]methyl formate (PubChem CID 155685271) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is ethane;[4-(ethoxymethyl)phenoxy]methyl formate.
Molecular Properties
| Compound Name | ethane;[4-(ethoxymethyl)phenoxy]methyl formate |
| PubChem CID | 155685271 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethane;[4-(ethoxymethyl)phenoxy]methyl formate |
| SMILES | CC.CCOCc1ccc(OCOC=O)cc1 |
| InChI | InChI=1S/C11H14O4.C2H6/c1-2-13-7-10-3-5-11(6-4-10)15-9-14-8-12;1-2/h3-6,8H,2,7,9H2,1H3;1-2H3 |
| InChIKey | VXIBVLHUAYNLQE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-(ethoxymethyl)phenoxy]methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-(ethoxymethyl)phenoxy]methyl formate?
The IUPAC name of ethane;[4-(ethoxymethyl)phenoxy]methyl formate (CID 155685271) is ethane;[4-(ethoxymethyl)phenoxy]methyl formate.
What is the SMILES notation for ethane;[4-(ethoxymethyl)phenoxy]methyl formate?
The canonical SMILES for ethane;[4-(ethoxymethyl)phenoxy]methyl formate is CC.CCOCc1ccc(OCOC=O)cc1.
What is the InChIKey of ethane;[4-(ethoxymethyl)phenoxy]methyl formate?
The InChIKey is VXIBVLHUAYNLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4.C2H6/c1-2-13-7-10-3-5-11(6-4-10)15-9-14-8-12;1-2/h3-6,8H,2,7,9H2,1H3;1-2H3.
What are the key properties of ethane;[4-(ethoxymethyl)phenoxy]methyl formate?
ethane;[4-(ethoxymethyl)phenoxy]methyl formate has a molecular weight of 240.30 g/mol, XLogP of 2.76, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-(ethoxymethyl)phenoxy]methyl formate is sourced from PubChem (CID 155685271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).