C14H14O3 — CID 155685936
6-hydroxy-3,5,8-trimethylnaphthalene-2-carboxylic acid (PubChem CID 155685936) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 6-hydroxy-3,5,8-trimethylnaphthalene-2-carboxylic acid.
| Compound Name | 6-hydroxy-3,5,8-trimethylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 155685936 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-hydroxy-3,5,8-trimethylnaphthalene-2-carboxylic acid |
| SMILES | Cc1cc2c(C)c(O)cc(C)c2cc1C(=O)O |
| InChI | InChI=1S/C14H14O3/c1-7-4-12-9(3)13(15)5-8(2)10(12)6-11(7)14(16)17/h4-6,15H,1-3H3,(H,16,17) |
| InChIKey | OHNZXIHUEIROIQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |