C26H37ClF2N4O — CID 155686692
N-[[3-amino-5-(1,1-difluoroethyl)phenyl]methyl]-6-butyl-2-chloro-5-ethylpyrimidin-4-amine;3-methyl-3-prop-1-en-2-yloxetane (PubChem CID 155686692) has the molecular formula C26H37ClF2N4O and a molecular weight of 495.06 g/mol. Its IUPAC name is N-[[3-amino-5-(1,1-difluoroethyl)phenyl]methyl]-6-butyl-2-chloro-5-ethylpyrimidin-4-amine;3-methyl-3-prop-1-en-2-yloxetane.
| Compound Name | N-[[3-amino-5-(1,1-difluoroethyl)phenyl]methyl]-6-butyl-2-chloro-5-ethylpyrimidin-4-amine;3-methyl-3-prop-1-en-2-yloxetane |
|---|---|
| PubChem CID | 155686692 |
| Molecular Formula | C26H37ClF2N4O |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | N-[[3-amino-5-(1,1-difluoroethyl)phenyl]methyl]-6-butyl-2-chloro-5-ethylpyrimidin-4-amine;3-methyl-3-prop-1-en-2-yloxetane |
| SMILES | C=C(C)C1(C)COC1.CCCCc1nc(Cl)nc(NCc2cc(N)cc(C(C)(F)F)c2)c1CC |
| InChI | InChI=1S/C19H25ClF2N4.C7H12O/c1-4-6-7-16-15(5-2)17(26-18(20)25-16)24-11-12-8-13(19(3,21)22)10-14(23)9-12;1-6(2)7(3)4-8-5-7/h8-10H,4-7,11,23H2,1-3H3,(H,24,25,26);1,4-5H2,2-3H3 |
| InChIKey | LQUANNFULPUDAB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|