C21H20F4N6 — CID 44532563
2-[4-[2-(3-fluorophenyl)ethylamino]-6-methylpyrimidin-2-yl]-1-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 44532563) has the molecular formula C21H20F4N6 and a molecular weight of 432.43 g/mol. Its IUPAC name is 2-[4-[2-(3-fluorophenyl)ethylamino]-6-methylpyrimidin-2-yl]-1-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[4-[2-(3-fluorophenyl)ethylamino]-6-methylpyrimidin-2-yl]-1-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 44532563 |
| Molecular Formula | C21H20F4N6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[4-[2-(3-fluorophenyl)ethylamino]-6-methylpyrimidin-2-yl]-1-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | Cc1cc(NCCc2cccc(F)c2)nc(/N=C(\N)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H20F4N6/c1-13-10-18(27-9-8-14-4-2-6-16(22)11-14)30-20(28-13)31-19(26)29-17-7-3-5-15(12-17)21(23,24)25/h2-7,10-12H,8-9H2,1H3,(H4,26,27,28,29,30,31) |
| InChIKey | BMRFPRVTLYVWJL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|