C25H36ClF3N6O — CID 155686810
2-chloro-N-[[3-(difluoromethyl)-2-fluorophenyl]methyl]-5,6-diethylpyrimidin-4-amine;ethane;2-methyl-3,5,7,7a-tetrahydro-1H-imidazo[1,5-c]imidazole-6-carbaldehyde (PubChem CID 155686810) has the molecular formula C25H36ClF3N6O and a molecular weight of 529.05 g/mol. Its IUPAC name is 2-chloro-N-[[3-(difluoromethyl)-2-fluorophenyl]methyl]-5,6-diethylpyrimidin-4-amine;ethane;2-methyl-3,5,7,7a-tetrahydro-1H-imidazo[1,5-c]imidazole-6-carbaldehyde.
| Compound Name | 2-chloro-N-[[3-(difluoromethyl)-2-fluorophenyl]methyl]-5,6-diethylpyrimidin-4-amine;ethane;2-methyl-3,5,7,7a-tetrahydro-1H-imidazo[1,5-c]imidazole-6-carbaldehyde |
|---|---|
| PubChem CID | 155686810 |
| Molecular Formula | C25H36ClF3N6O |
| Molecular Weight | 529.05 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-chloro-N-[[3-(difluoromethyl)-2-fluorophenyl]methyl]-5,6-diethylpyrimidin-4-amine;ethane;2-methyl-3,5,7,7a-tetrahydro-1H-imidazo[1,5-c]imidazole-6-carbaldehyde |
| SMILES | CC.CCc1nc(Cl)nc(NCc2cccc(C(F)F)c2F)c1CC.CN1CC2CN(C=O)CN2C1 |
| InChI | InChI=1S/C16H17ClF3N3.C7H13N3O.C2H6/c1-3-10-12(4-2)22-16(17)23-15(10)21-8-9-6-5-7-11(13(9)18)14(19)20;1-8-2-7-3-9(6-11)5-10(7)4-8;1-2/h5-7,14H,3-4,8H2,1-2H3,(H,21,22,23);6-7H,2-5H2,1H3;1-2H3 |
| InChIKey | NAHDANGYROYTIK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.05 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|