C20H23F3N6O2 — CID 155686868
5-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-1-methyl-3-(oxan-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 155686868) has the molecular formula C20H23F3N6O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 5-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-1-methyl-3-(oxan-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 5-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-1-methyl-3-(oxan-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 155686868 |
| Molecular Formula | C20H23F3N6O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 5-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-1-methyl-3-(oxan-4-yl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CN1C(=O)N(C2CCOCC2)Cc2c(NCc3cc(N)cc(C(F)(F)F)c3)ncnc21 |
| InChI | InChI=1S/C20H23F3N6O2/c1-28-18-16(10-29(19(28)30)15-2-4-31-5-3-15)17(26-11-27-18)25-9-12-6-13(20(21,22)23)8-14(24)7-12/h6-8,11,15H,2-5,9-10,24H2,1H3,(H,25,26,27) |
| InChIKey | VGTOIWJTKMLIFA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|