C11H27NO — CID 155689361
N,N-dimethyl-4-propan-2-yloxybutan-2-amine;ethane (PubChem CID 155689361) has the molecular formula C11H27NO and a molecular weight of 189.34 g/mol. Its IUPAC name is N,N-dimethyl-4-propan-2-yloxybutan-2-amine;ethane.
| Compound Name | N,N-dimethyl-4-propan-2-yloxybutan-2-amine;ethane |
|---|---|
| PubChem CID | 155689361 |
| Molecular Formula | C11H27NO |
| Molecular Weight | 189.34 g/mol |
| Exact Mass | 189.21 |
| IUPAC Name | N,N-dimethyl-4-propan-2-yloxybutan-2-amine;ethane |
| SMILES | CC.CC(C)OCCC(C)N(C)C |
| InChI | InChI=1S/C9H21NO.C2H6/c1-8(2)11-7-6-9(3)10(4)5;1-2/h8-9H,6-7H2,1-5H3;1-2H3 |
| InChIKey | RMJSCHRGSBPPSJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |