C9H21NO — CID 547393
3-butoxy-N,N-dimethylpropan-1-amine (PubChem CID 547393) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is 3-butoxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-butoxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 547393 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 3-butoxy-N,N-dimethylpropan-1-amine |
| SMILES | CCCCOCCCN(C)C |
| InChI | InChI=1S/C9H21NO/c1-4-5-8-11-9-6-7-10(2)3/h4-9H2,1-3H3 |
| InChIKey | SCSCNTOYWUFFCE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|