C12H30I2N2O — CID 46899
Ammonium, oxybis(trimethylene)bis(trimethyl-, diiodide (PubChem CID 46899) has the molecular formula C12H30I2N2O and a molecular weight of 472.19 g/mol. Its IUPAC name is trimethyl-[3-[3-(trimethylazaniumyl)propoxy]propyl]azanium diiodide.
| Compound Name | Ammonium, oxybis(trimethylene)bis(trimethyl-, diiodide |
|---|---|
| PubChem CID | 46899 |
| Molecular Formula | C12H30I2N2O |
| Molecular Weight | 472.19 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | trimethyl-[3-[3-(trimethylazaniumyl)propoxy]propyl]azanium diiodide |
| SMILES | C[N+](C)(C)CCCOCCC[N+](C)(C)C.[I-].[I-] |
| InChI | InChI=1S/C12H30N2O.2HI/c1-13(2,3)9-7-11-15-12-8-10-14(4,5)6;;/h7-12H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | BDMHRDJIKJNRKY-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | 138 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|