C16H38I2N2O — CID 46893
3,3'-Oxybis(N,N-diethyl-N-methylpropan-1-aminium) diiodide (PubChem CID 46893) has the molecular formula C16H38I2N2O and a molecular weight of 528.29 g/mol. Its IUPAC name is 3-[3-[diethyl(methyl)azaniumyl]propoxy]propyl-diethyl-methylazanium diiodide.
| Compound Name | 3,3'-Oxybis(N,N-diethyl-N-methylpropan-1-aminium) diiodide |
|---|---|
| PubChem CID | 46893 |
| Molecular Formula | C16H38I2N2O |
| Molecular Weight | 528.29 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 3-[3-[diethyl(methyl)azaniumyl]propoxy]propyl-diethyl-methylazanium diiodide |
| SMILES | CC[N+](C)(CC)CCCOCCC[N+](C)(CC)CC.[I-].[I-] |
| InChI | InChI=1S/C16H38N2O.2HI/c1-7-17(5,8-2)13-11-15-19-16-12-14-18(6,9-3)10-4;;/h7-16H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | HAHHOMVBRQUNQK-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | 189 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|