About 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane
4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane (PubChem CID 155689502) has the molecular formula C25H46ClN5OS
and a molecular weight of 500.20 g/mol. Its IUPAC name is 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane.
Molecular Properties
| Compound Name | 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane |
| PubChem CID | 155689502 |
| Molecular Formula | C25H46ClN5OS |
| Molecular Weight | 500.20 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane |
| SMILES | CC.CC.CSc1nc(Cl)nc2nc(C)n(CCCCCCCCCCN3CCOCC3)c12 |
| InChI | InChI=1S/C21H34ClN5OS.2C2H6/c1-17-23-19-18(20(29-2)25-21(22)24-19)27(17)12-10-8-6-4-3-5-7-9-11-26-13-15-28-16-14-26;2*1-2/h3-16H2,1-2H3;2*1-2H3 |
| InChIKey | VPKVJYKVAQNYOR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.20 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane?
The IUPAC name of 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane (CID 155689502) is 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane.
What is the SMILES notation for 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane?
The canonical SMILES for 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane is CC.CC.CSc1nc(Cl)nc2nc(C)n(CCCCCCCCCCN3CCOCC3)c12.
What is the InChIKey of 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane?
The InChIKey is VPKVJYKVAQNYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34ClN5OS.2C2H6/c1-17-23-19-18(20(29-2)25-21(22)24-19)27(17)12-10-8-6-4-3-5-7-9-11-26-13-15-28-16-14-26;2*1-2/h3-16H2,1-2H3;2*1-2H3.
What are the key properties of 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane?
4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane has a molecular weight of 500.20 g/mol, XLogP of 7.02, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[10-(2-chloro-8-methyl-6-methylsulfanylpurin-7-yl)decyl]morpholine;ethane is sourced from PubChem (CID 155689502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).