About [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene
[2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene (PubChem CID 155690779) has the molecular formula C26H30N2O2
and a molecular weight of 402.54 g/mol. Its IUPAC name is [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene.
Molecular Properties
| Compound Name | [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene |
| PubChem CID | 155690779 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene |
| SMILES | CNc1ccccc1C(=O)c1ccccc1.Cc1ccccc1.O=CC1CCCN1 |
| InChI | InChI=1S/C14H13NO.C7H8.C5H9NO/c1-15-13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11;1-7-5-3-2-4-6-7;7-4-5-2-1-3-6-5/h2-10,15H,1H3;2-6H,1H3;4-6H,1-3H2 |
| InChIKey | HTPWXWZLYWFZEQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene?
The IUPAC name of [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene (CID 155690779) is [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene.
What is the SMILES notation for [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene?
The canonical SMILES for [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene is CNc1ccccc1C(=O)c1ccccc1.Cc1ccccc1.O=CC1CCCN1.
What is the InChIKey of [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene?
The InChIKey is HTPWXWZLYWFZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO.C7H8.C5H9NO/c1-15-13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11;1-7-5-3-2-4-6-7;7-4-5-2-1-3-6-5/h2-10,15H,1H3;2-6H,1H3;4-6H,1-3H2.
What are the key properties of [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene?
[2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene has a molecular weight of 402.54 g/mol, XLogP of 4.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)phenyl]-phenylmethanone;pyrrolidine-2-carbaldehyde;toluene is sourced from PubChem (CID 155690779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).