C31H27ClF4N5O3Si — CID 155691211
CID 155691211 (PubChem CID 155691211) has the molecular formula C31H27ClF4N5O3Si and a molecular weight of 657.12 g/mol.
| Compound Name | CID 155691211 |
|---|---|
| PubChem CID | 155691211 |
| Molecular Formula | C31H27ClF4N5O3Si |
| Molecular Weight | 657.12 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1ccc(-n2c(N[Si](C)c3ccc(F)cc3)nc3c(c2=O)C[C@@H](C)N(C(=O)c2ccc(Cl)c(C(F)(F)F)c2)C3)cc1 |
| InChI | InChI=1S/C31H27ClF4N5O3Si/c1-17-14-23-26(16-40(17)28(43)19-6-13-25(32)24(15-19)31(34,35)36)38-30(39-45(3)22-11-7-20(33)8-12-22)41(29(23)44)21-9-4-18(5-10-21)27(42)37-2/h4-13,15,17H,14,16H2,1-3H3,(H,37,42)(H,38,39)/t17-/m1/s1 |
| InChIKey | CRBJCOBXZWOESX-QGZVFWFLSA-N |
| XLogP | 4.93 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.12 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|