C29H27Cl2F3N7O3Si — CID 155691274
CID 155691274 (PubChem CID 155691274) has the molecular formula C29H27Cl2F3N7O3Si and a molecular weight of 677.57 g/mol.
| Compound Name | CID 155691274 |
|---|---|
| PubChem CID | 155691274 |
| Molecular Formula | C29H27Cl2F3N7O3Si |
| Molecular Weight | 677.57 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1ncc(-n2c(N[Si](C)c3ccc(C(F)(F)F)cc3)nc3c(c2=O)C[C@@H](C)N(C(=O)c2ccc(Cl)c(Cl)c2)C3)n1C |
| InChI | InChI=1S/C29H27Cl2F3N7O3Si/c1-15-11-19-22(14-40(15)26(43)16-5-10-20(30)21(31)12-16)37-28(38-45(4)18-8-6-17(7-9-18)29(32,33)34)41(27(19)44)23-13-36-24(39(23)3)25(42)35-2/h5-10,12-13,15H,11,14H2,1-4H3,(H,35,42)(H,37,38)/t15-/m1/s1 |
| InChIKey | DXPKKNHHUFYSJK-OAHLLOKOSA-N |
| XLogP | 4.18 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|