C11H15F2N2O4+ — CID 155692174
[(2R)-1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]azanium (PubChem CID 155692174) has the molecular formula C11H15F2N2O4+ and a molecular weight of 277.25 g/mol. Its IUPAC name is [(2R)-1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]azanium.
| Compound Name | [(2R)-1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]azanium |
|---|---|
| PubChem CID | 155692174 |
| Molecular Formula | C11H15F2N2O4+ |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [(2R)-1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-yl]azanium |
| SMILES | COc1c([N+](=O)[O-])cc(COC[C@@H](C)[NH3+])c(F)c1F |
| InChI | InChI=1S/C11H14F2N2O4/c1-6(14)4-19-5-7-3-8(15(16)17)11(18-2)10(13)9(7)12/h3,6H,4-5,14H2,1-2H3/p+1/t6-/m1/s1 |
| InChIKey | GNEQJUALKUAAJA-ZCFIWIBFSA-O |
| XLogP | 1.03 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|