C12H16N+ — CID 155692520
2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium (PubChem CID 155692520) has the molecular formula C12H16N+ and a molecular weight of 174.27 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium.
| Compound Name | 2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium |
|---|---|
| PubChem CID | 155692520 |
| Molecular Formula | C12H16N+ |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium |
| SMILES | C=C/[N+](C)=C/C(=C)C1=CC=CCC1 |
| InChI | InChI=1S/C12H16N/c1-4-13(3)10-11(2)12-8-6-5-7-9-12/h4-6,8,10H,1-2,7,9H2,3H3/q+1/b13-10+ |
| InChIKey | HADZMMGMIZCPJY-JLHYYAGUSA-N |
| XLogP | 2.68 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|