C14H22N+ — CID 155692769
2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium;ethane (PubChem CID 155692769) has the molecular formula C14H22N+ and a molecular weight of 204.34 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium;ethane.
| Compound Name | 2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium;ethane |
|---|---|
| PubChem CID | 155692769 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-ylprop-2-enylidene-ethenyl-methylazanium;ethane |
| SMILES | C=C/[N+](C)=C/C(=C)C1=CC=CCC1.CC |
| InChI | InChI=1S/C12H16N.C2H6/c1-4-13(3)10-11(2)12-8-6-5-7-9-12;1-2/h4-6,8,10H,1-2,7,9H2,3H3;1-2H3/q+1;/b13-10+; |
| InChIKey | PYUQRXSBOPJGLW-RSGUCCNWSA-N |
| XLogP | 3.70 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|