C37H70N8O7 — CID 155693434
6-(aminomethyl)-3-(3-aminopropoxymethyl)-9-cyclohexyl-16-hexyl-15-(2-methoxyethyl)-13-methyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone (PubChem CID 155693434) has the molecular formula C37H70N8O7 and a molecular weight of 739.02 g/mol. Its IUPAC name is 6-(aminomethyl)-3-(3-aminopropoxymethyl)-9-cyclohexyl-16-hexyl-15-(2-methoxyethyl)-13-methyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone.
| Compound Name | 6-(aminomethyl)-3-(3-aminopropoxymethyl)-9-cyclohexyl-16-hexyl-15-(2-methoxyethyl)-13-methyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 155693434 |
| Molecular Formula | C37H70N8O7 |
| Molecular Weight | 739.02 g/mol |
| Exact Mass | 738.54 |
| IUPAC Name | 6-(aminomethyl)-3-(3-aminopropoxymethyl)-9-cyclohexyl-16-hexyl-15-(2-methoxyethyl)-13-methyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
| SMILES | CCCCCCN1CCNC(=O)C(COCCCN)NC(=O)C(CN)NC(=O)C(C2CCCCC2)NC(=O)C(CC(C)C)N(C)C(=O)C1CCOC |
| InChI | InChI=1S/C37H70N8O7/c1-6-7-8-12-19-45-20-18-40-33(46)29(25-52-21-13-17-38)42-34(47)28(24-39)41-36(49)32(27-14-10-9-11-15-27)43-35(48)31(23-26(2)3)44(4)37(50)30(45)16-22-51-5/h26-32H,6-25,38-39H2,1-5H3,(H,40,46)(H,41,49)(H,42,47)(H,43,48) |
| InChIKey | KGGDONLCMADZSF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 210.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.02 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|