C23H22F5NO4 — CID 155695166
benzyl 4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-2-[methyl(prop-2-enoxycarbonyl)amino]butanoate (PubChem CID 155695166) has the molecular formula C23H22F5NO4 and a molecular weight of 471.42 g/mol. Its IUPAC name is benzyl 4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-2-[methyl(prop-2-enoxycarbonyl)amino]butanoate.
| Compound Name | benzyl 4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-2-[methyl(prop-2-enoxycarbonyl)amino]butanoate |
|---|---|
| PubChem CID | 155695166 |
| Molecular Formula | C23H22F5NO4 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | benzyl 4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-2-[methyl(prop-2-enoxycarbonyl)amino]butanoate |
| SMILES | C=CCOC(=O)N(C)C(CCc1cc(F)c(C(F)(F)F)c(F)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H22F5NO4/c1-3-11-32-22(31)29(2)19(21(30)33-14-15-7-5-4-6-8-15)10-9-16-12-17(24)20(18(25)13-16)23(26,27)28/h3-8,12-13,19H,1,9-11,14H2,2H3 |
| InChIKey | KFJZUYXZJOFBES-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|