C17H26N2O6 — CID 155696534
(2,5-dioxopyrrolidin-1-yl) 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate;ethane (PubChem CID 155696534) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate;ethane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate;ethane |
|---|---|
| PubChem CID | 155696534 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoate;ethane |
| SMILES | CC.CN(CCCCCC(=O)ON1C(=O)CCC1=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C15H20N2O6.C2H6/c1-16(12(19)6-5-11-18)10-4-2-3-7-15(22)23-17-13(20)8-9-14(17)21;1-2/h5-6,11H,2-4,7-10H2,1H3;1-2H3/b6-5-; |
| InChIKey | SEQILZBJHPLEAC-YSMBQZINSA-N |
| XLogP | 1.39 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|