C27H34BrN5O2 — CID 155696689
1-(4-aminobutyl)-8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 155696689) has the molecular formula C27H34BrN5O2 and a molecular weight of 540.51 g/mol. Its IUPAC name is 1-(4-aminobutyl)-8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(4-aminobutyl)-8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 155696689 |
| Molecular Formula | C27H34BrN5O2 |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 1-(4-aminobutyl)-8-bromo-2-butyl-N-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(NCc3ccc(OC)cc3OC)nc3ccc(Br)cc3c2n1CCCCN |
| InChI | InChI=1S/C27H34BrN5O2/c1-4-5-8-24-32-25-26(33(24)14-7-6-13-29)21-15-19(28)10-12-22(21)31-27(25)30-17-18-9-11-20(34-2)16-23(18)35-3/h9-12,15-16H,4-8,13-14,17,29H2,1-3H3,(H,30,31) |
| InChIKey | FYQKXBLDAMDUSN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|