C24H29F3N2 — CID 155696897
3-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 155696897) has the molecular formula C24H29F3N2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 155696897 |
| Molecular Formula | C24H29F3N2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 3-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3cc(N)cc(C(F)(F)F)c3)cc1)C2 |
| InChI | InChI=1S/C24H29F3N2/c1-15-7-16-9-17(8-15)14-23(2,13-16)18-3-5-21(6-4-18)29-22-11-19(24(25,26)27)10-20(28)12-22/h3-6,10-12,15-17,29H,7-9,13-14,28H2,1-2H3 |
| InChIKey | JXNROIDFVZYXBR-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|