C21H26F3N — CID 171714685
3,5-ditert-butyl-N-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 171714685) has the molecular formula C21H26F3N and a molecular weight of 349.44 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 3,5-ditert-butyl-N-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 171714685 |
| Molecular Formula | C21H26F3N |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3,5-ditert-butyl-N-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | CC(C)(C)c1cc(Nc2ccc(C(F)(F)F)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H26F3N/c1-19(2,3)15-11-16(20(4,5)6)13-18(12-15)25-17-9-7-14(8-10-17)21(22,23)24/h7-13,25H,1-6H3 |
| InChIKey | CGTHDPQTPULIAA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |