C23H27FN2O2 — CID 155696945
N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-3-fluoro-5-nitroaniline (PubChem CID 155696945) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-3-fluoro-5-nitroaniline.
| Compound Name | N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-3-fluoro-5-nitroaniline |
|---|---|
| PubChem CID | 155696945 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-3-fluoro-5-nitroaniline |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3cc(F)cc([N+](=O)[O-])c3)cc1)C2 |
| InChI | InChI=1S/C23H27FN2O2/c1-15-7-16-9-17(8-15)14-23(2,13-16)18-3-5-20(6-4-18)25-21-10-19(24)11-22(12-21)26(27)28/h3-6,10-12,15-17,25H,7-9,13-14H2,1-2H3 |
| InChIKey | ISOXSOXHIWUVDE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|