C23H30N2OS — CID 155697116
4-amino-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]benzenesulfinamide (PubChem CID 155697116) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is 4-amino-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]benzenesulfinamide.
| Compound Name | 4-amino-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]benzenesulfinamide |
|---|---|
| PubChem CID | 155697116 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4-amino-N-[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]benzenesulfinamide |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(NS(=O)c3ccc(N)cc3)cc1)C2 |
| InChI | InChI=1S/C23H30N2OS/c1-16-11-17-13-18(12-16)15-23(2,14-17)19-3-7-21(8-4-19)25-27(26)22-9-5-20(24)6-10-22/h3-10,16-18,25H,11-15,24H2,1-2H3 |
| InChIKey | BHEZQGVCYXSNLZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|