C23H29ClN2 — CID 155697186
4-N-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)phenyl]benzene-1,4-diamine (PubChem CID 155697186) has the molecular formula C23H29ClN2 and a molecular weight of 368.95 g/mol. Its IUPAC name is 4-N-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 155697186 |
| Molecular Formula | C23H29ClN2 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-N-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)phenyl]benzene-1,4-diamine |
| SMILES | CC1CC2CC(C)CC(c3ccc(Nc4ccc(N)cc4)c(Cl)c3)(C1)C2 |
| InChI | InChI=1S/C23H29ClN2/c1-15-9-17-10-16(2)13-23(12-15,14-17)18-3-8-22(21(24)11-18)26-20-6-4-19(25)5-7-20/h3-8,11,15-17,26H,9-10,12-14,25H2,1-2H3 |
| InChIKey | GSSADFKDMRHVLH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|