C24H28ClF3N2 — CID 155697304
3-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 155697304) has the molecular formula C24H28ClF3N2 and a molecular weight of 436.95 g/mol. Its IUPAC name is 3-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 3-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 155697304 |
| Molecular Formula | C24H28ClF3N2 |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-N-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3cc(N)cc(C(F)(F)F)c3)c(Cl)c1)C2 |
| InChI | InChI=1S/C24H28ClF3N2/c1-14-5-15-7-16(6-14)13-23(2,12-15)17-3-4-22(21(25)10-17)30-20-9-18(24(26,27)28)8-19(29)11-20/h3-4,8-11,14-16,30H,5-7,12-13,29H2,1-2H3 |
| InChIKey | SRPUNPKCBOIXDA-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|