C19H14ClF3N2 — CID 67733046
3-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-phenylbenzene-1,3-diamine (PubChem CID 67733046) has the molecular formula C19H14ClF3N2 and a molecular weight of 362.78 g/mol. Its IUPAC name is 3-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-phenylbenzene-1,3-diamine.
| Compound Name | 3-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-phenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 67733046 |
| Molecular Formula | C19H14ClF3N2 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-phenylbenzene-1,3-diamine |
| SMILES | Nc1ccc(-c2ccccc2)c(Nc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14ClF3N2/c20-13-6-9-17(16(10-13)19(21,22)23)25-18-11-14(24)7-8-15(18)12-4-2-1-3-5-12/h1-11,25H,24H2 |
| InChIKey | CMKDDEHJDAPNLX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|