C12H9ClF3N3 — CID 104532239
5-N-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-3,5-diamine (PubChem CID 104532239) has the molecular formula C12H9ClF3N3 and a molecular weight of 287.67 g/mol. Its IUPAC name is 5-N-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-3,5-diamine.
| Compound Name | 5-N-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532239 |
| Molecular Formula | C12H9ClF3N3 |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-N-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-3,5-diamine |
| SMILES | Nc1cncc(Nc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9ClF3N3/c13-7-1-2-11(10(3-7)12(14,15)16)19-9-4-8(17)5-18-6-9/h1-6,19H,17H2 |
| InChIKey | LGNZQTNHSHOQFH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |