C9H8ClN3S — CID 130834562
5-N-(2-chlorothiophen-3-yl)pyridine-3,5-diamine (PubChem CID 130834562) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 5-N-(2-chlorothiophen-3-yl)pyridine-3,5-diamine.
| Compound Name | 5-N-(2-chlorothiophen-3-yl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 130834562 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 5-N-(2-chlorothiophen-3-yl)pyridine-3,5-diamine |
| SMILES | Nc1cncc(Nc2ccsc2Cl)c1 |
| InChI | InChI=1S/C9H8ClN3S/c10-9-8(1-2-14-9)13-7-3-6(11)4-12-5-7/h1-5,13H,11H2 |
| InChIKey | FFZGVPJPAWYROI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |