C11H8F3N3 — CID 113423984
5-N-(2,3,5-trifluorophenyl)pyridine-3,5-diamine (PubChem CID 113423984) has the molecular formula C11H8F3N3 and a molecular weight of 239.20 g/mol. Its IUPAC name is 5-N-(2,3,5-trifluorophenyl)pyridine-3,5-diamine.
| Compound Name | 5-N-(2,3,5-trifluorophenyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 113423984 |
| Molecular Formula | C11H8F3N3 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 5-N-(2,3,5-trifluorophenyl)pyridine-3,5-diamine |
| SMILES | Nc1cncc(Nc2cc(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C11H8F3N3/c12-6-1-9(13)11(14)10(2-6)17-8-3-7(15)4-16-5-8/h1-5,17H,15H2 |
| InChIKey | QHNKXRVUDWKVHP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|