C33H47ClN2O2 — CID 155697223
methyl 3-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]-2-propylhexanoate (PubChem CID 155697223) has the molecular formula C33H47ClN2O2 and a molecular weight of 539.20 g/mol. Its IUPAC name is methyl 3-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]-2-propylhexanoate.
| Compound Name | methyl 3-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]-2-propylhexanoate |
|---|---|
| PubChem CID | 155697223 |
| Molecular Formula | C33H47ClN2O2 |
| Molecular Weight | 539.20 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | methyl 3-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]-2-propylhexanoate |
| SMILES | CCCC(Nc1ccc(Nc2ccc(C3(C)CC4CC(C)CC(C4)C3)cc2Cl)cc1)C(CCC)C(=O)OC |
| InChI | InChI=1S/C33H47ClN2O2/c1-6-8-28(32(37)38-5)30(9-7-2)35-26-11-13-27(14-12-26)36-31-15-10-25(19-29(31)34)33(4)20-23-16-22(3)17-24(18-23)21-33/h10-15,19,22-24,28,30,35-36H,6-9,16-18,20-21H2,1-5H3 |
| InChIKey | UUUSXLNROZSEEN-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.20 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|