C31H41ClN2O2 — CID 155697017
ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carboxylate (PubChem CID 155697017) has the molecular formula C31H41ClN2O2 and a molecular weight of 509.13 g/mol. Its IUPAC name is ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 155697017 |
| Molecular Formula | C31H41ClN2O2 |
| Molecular Weight | 509.13 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCC1Nc1ccc(Nc2ccc(C3(C)CC4CC(C)CC(C4)C3)cc2Cl)cc1 |
| InChI | InChI=1S/C31H41ClN2O2/c1-4-36-30(35)26-6-5-7-28(26)33-24-9-11-25(12-10-24)34-29-13-8-23(17-27(29)32)31(3)18-21-14-20(2)15-22(16-21)19-31/h8-13,17,20-22,26,28,33-34H,4-7,14-16,18-19H2,1-3H3 |
| InChIKey | QTMVDZKHAWRZES-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.13 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|